Didesipramine
Didesipramine is used to treat depression. Desipramine is in a class of medications called tricyclic antidepressants. It works by increasing the amounts of certain natural substances in the brain that are needed for mental balance.
| Supplier | Ace Therapeutics |
|---|---|
| Product # | SMD801 |
| CAS # | 2095-95-6 |
| Pricing | Customizable size, Inquiry |
| Synonym | Didesipramine; GP36526; GP-36526; GP 36526 |
| Product Category | Lab-use Small Molecule Drugs |
| Chemical Formula | C17H20N2 |
| Exact Mass | 252.1626 |
| Molecular Weight | 252.36 |
| Elemental Analysis | C, 80.91; H, 7.99; N, 11.10 |
| IUPAC/Chemical Name | 5H-Dibenz(b,f)azepine, 10,11-dihydro-5-(3-aminopropyl)- |
| InChi Key | XJWJQDZWUYUIEM-UHFFFAOYSA-N |
| InChi Code | InChI=1S/C17H20N2/c18-12-5-13-19-16-8-3-1-6-14(16)10-11-15-7-2-4-9-17(15)19/h1-4,6-9H,5,10-13,18H2 |
| SMILES Code | NCCCN1C2=CC=CC=C2CCC3=CC=CC=C31 |
| Appearance | Solid powder |
| Purity | >98% (or refer to the Certificate of Analysis) |
| Shipping Condition | Shipped under ambient temperature as non-hazardous chemical. This product is stable enough for a few weeks during ordinary shipping and time spent in Customs. |
| Storage Condition | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| Solubility | To be determined |
| Shelf Life | >2 years if stored properly |
| Drug Formulation | To be determined |
| Stock Solution Storage | 0 - 4℃ for short term (days to weeks), or -20℃ for long term (months). |
| HS Tariff Code | 2934.99.9001 |