7-Ethyl-10-hydroxycamptothecin
7-Ethyl-10-hydroxycamptothecin is a natural compound widely employed in the biomedical sector, showcasing remarkable potency in studying sundry malignancies such as colon, lung and ovarian cancers by impeding the functionality of topoisomerase I.
| Supplier | BOC Sciences |
|---|---|
| Product # | 130194-92-2 |
| Pricing | Inquire |
| Cas | 130194-92-2 |
| Molecular Weight | 364.357 |
| Molecular Formula | C20H16N2O5 |
| Canonical SMILES | CCC1(C2=C(COC1=O)C(=O)N3CC4=C(C3=C2)NC5=CC=CC(=O)C5=C4)O |