Benzyl Isononyl Phthalate (mixture of branched chain isomers)
Benzyl Isononyl Phthalate (mixture of branched chain isomers) is a versatile compound widely used in the biomedical industry as a plasticizer in various medical devices and medications. This mixture of branched chain isomers exhibits excellent compatibility and stability when incorporated into drug formulations, enabling controlled release and enhancing drug absorption. It finds applications in the drug development of cardiovascular diseases, inflammatory disorders, and cancer therapies, among others.
| Supplier | BOC Sciences |
|---|---|
| Product # | 126198-74-1 |
| Pricing | Inquire |
| Cas | 126198-74-1 |
| Molecular Weight | 382.5 |
| Molecular Formula | C24H30O4 |
| Canonical SMILES | CC(C)CCCCCCOC(=O)C1=CC=CC=C1C(=O)OCC2=CC=CC=C2 |