Ezetimibe Azetidinone Ring-opened Impurity
An impurity of Ezetimibe. Ezetimibe inhibits intestinal cholesterol absorption by preventing cholesterol uptake by the Niemann-Pick C1-like 1 (NPC1L8) protein, a cholesterol transporter located in the apical membrane of enterocytes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1391053-63-6 |
| Pricing | Inquire |
| Cas | 1391053-63-6 |
| Molecular Weight | 427.45 |
| Molecular Formula | C24H23F2NO4 |
| Canonical SMILES | C1=CC(=CC=C1C(C(CCC(C2=CC=C(C=C2)F)O)C(=O)O)NC3=CC=C(C=C3)F)O |