2,3-Dimethoxy-6-methyl-7-(phenylmethyl)-4-propyl-1-naphthalenecarboxylic Acid
2,3-Dimethoxy-6-methyl-7-(phenylmethyl)-4-propyl-1-naphthalenecarboxylic Acid is an intermediate formed in the synthesis of 2,3-Dihydroxy-6-methyl-7-(phenylmethyl)-4-propyl-1-naphthalenecarboxylic Acid (D453265), which is used in the synthesis of novel lactate dehydrogenase A inhibitors. This compound is suitable for lactate dehydrogenase (LDH) related research.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB067502 |
| Pricing | Inquire |
| Cas | 213971-47-2 |
| Molecular Weight | 378.46 |
| Molecular Formula | C24H26O4 |
| Canonical SMILES | CCCC1=C(C(=C(C2=C1C=C(C(=C2)CC3=CC=CC=C3)C)C(=O)O)OC)OC |