3,5,6-Trichloro-2-pyridinol b-D-glucuronide
3,5,6-Trichloro-2-pyridinol b-D-glucuronide is a crucial compound used in the biomedical industry to study the metabolism and elimination of pesticides such as chlorpyrifos. It serving as a biomarker to assess exposure levels and evaluate the efficacy of detoxification processes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 58997-12-9 |
| Pricing | Inquire |
| Cas | 58997-12-9 |
| Molecular Weight | 374.56 |
| Molecular Formula | C11H10Cl3NO7 |
| Canonical SMILES | C1=C(C(=NC(=C1Cl)Cl)OC2C(C(C(C(O2)C(=O)O)O)O)O)Cl |