19-O-Acetylchaetoglobosin A
19-O-acetylchaetoglobosin A is a cytochalasan alkaloid and it is the acetyl derivative of chaetoglobosin A. It is an epoxide, a cytochalasan alkaloid, a member of indoles and a macrocycle. 19-O-acetylchaetoglobosin A is isolated from Chaetomium globosum and Chaetomium brasiliense and has a role as a Chaetomium metabolite.
| Supplier | BOC Sciences |
|---|---|
| Product # | 50939-69-0 |
| Pricing | Inquire |
| Cas | 50939-69-0 |
| Molecular Weight | 570.67 |
| Molecular Formula | C34H38N2O6 |
| Canonical SMILES | CC1CC=CC2C3C(O3)(C(C4C2(C(=O)C=CC(=O)C(C(=C1)C)OC(=O)C)C(=O)NC4CC5=CNC6=CC=CC=C65)C)C |