Naphthol AS-BI b-D-glucuronide
Naphthol AS-BI b-D-glucuronide, a pivotal biomedicine compound employed in elucidating drug metabolism and hepatic functionality, conforms to glucuronidation of Naphthol AS-BI, a biomedical research dye. Its significance lies in comprehending drug clearance, obliteration, and exploring ailments pertaining to the liver along with drug-triggered toxicity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 37-87-6 |
| Pricing | Inquire |
| Cas | 37-87-6 |
| Molecular Weight | 548.34 |
| Molecular Formula | C24H22BrNO9 |
| Canonical SMILES | COC1=CC=CC=C1NC(=O)C2=C(C=C3C=CC(=CC3=C2)Br)OC4C(C(C(C(O4)C(=O)O)O)O)O |