N-Methylindole-5-boronic acid
N-Methylindole-5-boronic acid is a profoundly significant compound predominantly employed in the domain of biomedicine and presents remarkable prospects pertaining to pharmacological advancement against diverse ailments, comprising neoplastic conditions and inflammation. Its chemical composition, uniquely distinct and idiosyncratic in nature, unveils auspicious avenues for the scientific populace to embark upon groundbreaking investigations and the unearthing of pioneering therapeutic modalities.
| Supplier | BOC Sciences |
|---|---|
| Product # | 192182-55-1 |
| Pricing | Inquire |
| Cas | 192182-55-1 |
| Molecular Weight | 174.99 |
| Molecular Formula | C9H10BNO2 |
| Canonical SMILES | B(C1=CC2=C(C=C1)N(C=C2)C)(O)O |