Angiotensin 1/2 (1-9) TFA
Angiotensin 1/2 (1-9) TFA contains the amino acids 1-9 that are converted from Angiotensin I/II peptide. It is an anti-cardiac hypertrophy drug with the functions of human metabolite, rat metabolite, antihypertensive agent and cardiac protective agent.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-016381 |
| Pricing | Inquire |
| Molecular Weight | 1297.36 |
| Molecular Formula | C58H79F3N16O15 |
| Canonical SMILES | CCC(C)C(C(=O)NC(CC1=CN=CN1)C(=O)N2CCCC2C(=O)NC(CC3=CC=CC=C3)C(=O)NC(CC4=CN=CN4)C(=O)O)NC(=O)C(CC5=CC=C(C=C5)O)NC(=O)C(C(C)C)NC(=O)C(CCCN=C(N)N)NC(=O)C(CC(=O)O)N.C(=O)(C(F)(F)F)O |