1,4-Cubanedicarboxylic acid
1,4-Cubanedicarboxylic acid (CAS# 32846-66-5) is a metal-organic framework. 1,4-Cubanedicarboxylic acid is used in the preparation of pH-sensitive hydrogels for oral delivery of hydrophobic drugs and in the synthesis of cubane-based chiral Schiff base ligands.
| Supplier | BOC Sciences |
|---|---|
| Product # | 32846-66-5 |
| Pricing | Inquire |
| Cas | 32846-66-5 |
| Molecular Weight | 192.17 |
| Molecular Formula | C10H8O4 |
| Canonical SMILES | C12C3C4C1(C5C2C3(C45)C(=O)O)C(=O)O |