Galbinic acid
Galbinic acid is a depsidone lichen metabolite originally isolated from U. undulata. It is active against the Gram-positive bacteria B. cereus, B. subtilis, and S. aureus, but not S. epidermidis (MICs = 62.5, 62.5, 250, and >250 µg/ml, respectively), as well as the Gram-negative bacterium E. coli, but not S. sonnei (MICs = 125 and >250 µg/ml, respectively).
| Supplier | BOC Sciences |
|---|---|
| Product # | 56691-88-4 |
| Pricing | Inquire |
| Cas | 56691-88-4 |
| Molecular Weight | 430.32 |
| Molecular Formula | C20H14O11 |
| Canonical SMILES | CC1=CC(=C(C2=C1C(=O)OC3=C(O2)C4=C(C(=C3COC(=O)C)O)C(=O)OC4O)C=O)O |