5-Fluorouracil N-b-D-glucuronide
5-Fluorouracil N-b-D-glucuronide is a noteworthy pharmaceutical compound, acting as an illustrious glucuronidated derivative intricately intertwined with 5-Fluorouracil. It can be used in research of malignancies encompassing breast, colon and dermal cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 66048-45-1 |
| Pricing | Inquire |
| Cas | 66048-45-1 |
| Molecular Weight | 306.20 |
| Molecular Formula | C10H11FN2O8 |
| Canonical SMILES | C1=C(C(=O)NC(=O)N1C2C(C(C(C(O2)C(=O)O)O)O)O)F |