Caspase-3/7 Inhibitor I
Caspase-3/7 inhibitor I is a potent, reversible, isatin sulfonamide-based inhibitor of caspase-3 (Ki(app) = 60 nM; IC50 = 120 nM) and caspase-7 (Ki(app) = 170 nM). It is a weaker inhibitor of caspase-9 with Ki(app) of 3.1 μM and caspase-1, caspase-2, caspase-4, caspase-6, and caspase-8 (Ki(app)s ≥25 μM). The basis for the unique selectivity of this compound for caspases 3 and 7 involves the recognition of three distinct hydrophobic residues in the S2 pocket surrounding the catalytic cysteine residue.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1110670-49-9 |
| Pricing | Inquire |
| Cas | 1110670-49-9 |
| Molecular Weight | 324.4 |
| Molecular Formula | C14H16N2O5S |
| Canonical SMILES | O=C(C1=CC(S(N2CCCC2COC)(=O)=O)=CC=C1N3)C3=O |