Salbutamol Impurity B
An impurity of salbutamol.Salbutamol is a short-acting, selective beta2-adrenergic receptor agonist used in the treatment of asthma and COPD. It is 29 times more selective for beta2 receptors than beta1 receptors giving it higher specificity for pulmonary beta receptors versus beta1-adrenergic receptors located in the heart
| Supplier | BOC Sciences |
|---|---|
| Product # | 96948-64-0 |
| Pricing | Inquire |
| Cas | 96948-64-0 |
| Molecular Weight | 209.29 |
| Molecular Formula | C12H19NO2 |
| Canonical SMILES | CC(C)(C)NCC(C1=CC=C(C=C1)O)O |