1-(3'-azido-3'-deoxy-β-D-ribofuranosyl)-5-nitro-2(1H)-pyridinone
1-(3'-azido-3'-deoxy-β-D-ribofuranosyl)-5-nitro-2(1H)-pyridinone, a highly efficacious antiviral agent, thrives in the realm of biomedical applications. It serves as a formidable combatant against an array of viral infections, principally those orchestrated by DNA and RNA viruses. By pinpointing viral enzymes and interfering with their functionality, this marvel of a compound effectively halts viral replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2072145-26-5 |
| Pricing | Inquire |
| Cas | 2072145-26-5 |
| Molecular Weight | 297.22 |
| Molecular Formula | C10H11N5O6 |
| Canonical SMILES | C1=CC(=O)N(C=C1[N+](=O)[O-])C2C(C(C(O2)CO)N=[N+]=[N-])O |