Ivabradine-[d3] Hydrochloride
Ivabradine-[d3] Hydrochloride is the labelled salt of Ivabradine. Ivabradine is an inhibitor of the sinoatrial node channel and can be used to treat chronic stable angina patients with normal sinus rhythm.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-011596 |
| Pricing | Inquire |
| Cas | 1217809-61-4 |
| Molecular Weight | 508.06 |
| Molecular Formula | C27H34D3ClN2O5 |
| Canonical SMILES | CN(CCCN1CCC2=CC(=C(C=C2CC1=O)OC)OC)CC3CC4=CC(=C(C=C34)OC)OC.Cl |