Heparin derived dp4 saccharide ammonium salt
Heparin derived dp4 saccharide ammonium salt, a biomedical compound derived from heparin, showcases profound therapeutic potential in treating blood clotting disorders and cardiovascular ailments. With its distinctive attributes as a dp4 saccharide ammonium salt, it exemplifies great efficacy in averting thrombosis and mitigating associated complexities.
| Supplier | BOC Sciences |
|---|---|
| Product # | 61844-85-7 |
| Pricing | Inquire |
| Cas | 61844-85-7 |
| Molecular Weight | 1074.9 |
| Molecular Formula | C24H38N2O35S5 |
| Canonical SMILES | C1=C(OC(C(C1O)OS(=O)(=O)O)OC2C(OC(C(C2O)NS(=O)(=O)O)OC3C(C(C(OC3C(=O)O)OC4C(OC(C(C4O)NS(=O)(=O)O)O)COS(=O)(=O)O)O)O)COS(=O)(=O)O)C(=O)O |