Carbonochloridic acid,5-methyl-2-(1-methylethyl)cyclohexyl ester, (1S,2R,5S)-
Carbonochloridic acid,5-methyl-2-(1-methylethyl)cyclohexyl ester, (1S,2R,5S)- is a chiral resolution reagent to separate racemic compounds into different mirror isomers and is an important tool for the production of optically active drugs.
| Supplier | BOC Sciences |
|---|---|
| Product # | 7635-54-3 |
| Pricing | Inquire |
| Cas | 7635-54-3 |
| Molecular Weight | 218.72 |
| Molecular Formula | C11H19 Cl O2 |
| Canonical SMILES | O=C(Cl)O[C@@H]1[C@@H](C(C)C)CC[C@H](C)C1 |