Dasabuvir-[d3]
Dasabuvir-[d3], is the labelled analogue of Dasabuvir. Dasabuvir is an antiviral drug for the treatment of hepatitis C. It inhibits hepatitis C virus (HCV) non-nucleoside NS5B palm polymerase to suppress RNA replicase. Dasabuvir is commonly used in combination with ombitasvir/paritaprevir/ritonavir to effect on HCV type 1.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002445 |
| Pricing | Inquire |
| Cas | 1957210-16-0 |
| Molecular Weight | 496.59 |
| Molecular Formula | C26H24D3N3O5S |
| Canonical SMILES | CC(C)(C)C1=CC(=CC(=C1OC)C2=CC3=C(C=C2)C=C(C=C3)NS(=O)(=O)C)N4C=CC(=O)NC4=O |