5'-Deoxy-5'-fluorothymidine
5'-Deoxy-5'-fluorothymidine, a compound of utmost significance in the biomedical field, manifests its indispensability in countering a diverse range of malignant neoplasms. Its profound therapeutic efficacy arises from its ability to impede the crucial enzymatic function of thymidylate synthase, pivotal for the replication and mending of DNA. Commencing with colorectal malignancies, this extraordinary product finds extensive utilization in chemotherapy protocols tailored for breast and pancreatic cancers as well.
| Supplier | BOC Sciences |
|---|---|
| Product # | 17199-43-8 |
| Pricing | Inquire |
| Cas | 17199-43-8 |
| Molecular Weight | 244.22 |
| Molecular Formula | C10H13FN2O4 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)CF)O |