rac Mirabegron-[d5]
rac Mirabegron-[d5] is the labelled analogue of Mirabegron. Mirabegron is an orally bioavailable agonist of the human beta-3 adrenergic receptor, and it is a drug for the treatment of overactive bladder.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-012553 |
| Pricing | Inquire |
| Cas | 1215807-38-7 |
| Molecular Weight | 401.54 |
| Molecular Formula | C21H19D5N4O2S |
| Canonical SMILES | C1=CC=C(C=C1)C(CNCCC2=CC=C(C=C2)NC(=O)CC3=CSC(=N3)N)O |