Losartan Methyl Ether
Losartan Methyl Ether is a formidable compound, primarily renowned for its remarkable prowess in studying hypertension and heart failure. As a discerning angiotensin II receptor antagonist, it efficaciously curtails blood pressure by obstructing the deleterious consequences of angiotensin II.
| Supplier | BOC Sciences |
|---|---|
| Product # | 114798-94-6 |
| Pricing | Inquire |
| Cas | 114798-94-6 |
| Molecular Weight | 436.94 |
| Molecular Formula | C23H25ClN6O |
| Canonical SMILES | CCCCC1=NC(=C(N1CC2=CC=C(C=C2)C3=CC=CC=C3C4=NNN=N4)COC)Cl |