9-Fluorenone-1-carboxylic acid
9-Fluorenone-1-carboxylic acid (CAS# 1573-92-8) is an intermediate in synthesizing Fluoren-1-ol (F462450), a metabolite of the PAH micropollutant Fluorene (F462002) with potential mutagenic effects. It is used as biomarkers to evaluate exposure to PAHs and environmental tobacco smoke in general population.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1573-92-8 |
| Pricing | Inquire |
| Cas | 1573-92-8 |
| Molecular Weight | 224.21 |
| Molecular Formula | C14H8O3 |
| Canonical SMILES | C1=CC=C2C(=C1)C3=C(C2=O)C(=CC=C3)C(=O)O |