1,2,3,4-Tetra-O-pivaloyl-b-D-glucuronide methyl ester
Inhibiting the activity of the enzymes crucial to the inflammation process, 1,2,3,4-Tetra-O-pivaloyl-b-D-glucuronide methyl ester serves as a crucial drug in treating inflammatory diseases like rheumatoid arthritis. Its therapeutic effect involves regulation of the immune system by modulating the activity of immune cells, thus curtailing the release of cytokines responsible for inflammation. In addition, its anti-inflammatory action extends beyond suppressing cytokine levels, owing to its ability to halt inflammation cascade reactions with marked efficacy, thereby making it a reliable remedy for patients suffering from inflammatory diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 86448-91-1 |
| Pricing | Inquire |
| Cas | 86448-91-1 |
| Molecular Weight | 544.63 |
| Molecular Formula | C27H44O11 |
| Canonical SMILES | CC(C)(C)C(=O)OC1C(C(OC(C1OC(=O)C(C)(C)C)OC(=O)C(C)(C)C)C(=O)OC)OC(=O)C(C)(C)C |