CARM1-IN-1 hydrochloride
CARM1-IN-1 hydrochloride is a potent and specific inhibitor of CARM1 (Coactivator-associated arginine methyltransferase 1) with an IC50 of 8.6 μM. It has very low activity against PRMT1 and SET7 with IC50s of >600 μM.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2070018-31-2 |
| Pricing | Inquire |
| Cas | 2070018-31-2 |
| Molecular Weight | 591.72 |
| Molecular Formula | C26H22Br2ClNO3 |
| Canonical SMILES | C1C(=CC2=CC(=C(C=C2)O)Br)C(=O)C(=CC3=CC(=C(C=C3)O)Br)CN1CC4=CC=CC=C4.Cl |