6-Ac-7'-OH-N-trityl morpholino adenosine
6-Ac-7'-OH-N-trityl morpholino adenosine may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting purine receptors or enzymes involved in purine metabolism. Its specific structure suggests potential biological activity, making it of interest in drug discovery or chemical biology research.
| Supplier | BOC Sciences |
|---|---|
| Product # | BRP-00742 |
| Pricing | Inquire |
| Molecular Weight | 534.62 |
| Molecular Formula | C31H30N6O3 |
| Canonical SMILES | CC(=O)NC1=C2C(=NC=N1)N(C=N2)C3CN(CC(O3)CO)C(C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6 |