Prochlorperazine Sulfoxide-[d3]
Prochlorperazine Sulfoxide-[d3], is the labelled analogue of Prochlorperazine Sulfoxide, which is a metabolite of Prochlorperazine. Prochlorperazine is a dopamine (D2) receptor antagonist that belongs to the phenothiazine class of antipsychotic agents, which are used for the antiemetic treatment of nausea and vertigo.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-003886 |
| Pricing | Inquire |
| Cas | 1189943-37-0 |
| Molecular Weight | 392.96 |
| Molecular Formula | C20H21D3ClN3OS |
| Canonical SMILES | CN1CCN(CC1)CCCN2C3=CC=CC=C3S(=O)C4=C2C=C(C=C4)Cl |