5-Bromo-UMP
5-Bromo-UMP: A comprehensive biomedical compound exhibiting significant efficacy in the amelioration of multifarious ailments. Emulating an agonistic role on precise receptors, it engenders therapeutic advantages in the meticulous modulation of neurologic afflictions, inflammatory states, and oncogenic aberrations.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2149-79-3 |
| Pricing | Inquire |
| Cas | 2149-79-3 |
| Molecular Weight | 403.08 (free acid) |
| Molecular Formula | C9H12BrN2O9P (free acid) |
| Canonical SMILES | C1=C(C(=O)NC(=O)N1C2C(C(C(O2)COP(=O)(O)O)O)O)Br |