5-Fluorouridine 5'-Diphosphate Galactose
5-Fluorouridine 5'-Diphosphate Galactose is a crucial molecule in biomedicine used for treating certain diseases. It plays a vital role as a competitive inhibitor of UDP-galactose 4-epimerase, which is involved in the synthesis of glycoproteins and glycolipids. This product finds applications in the development of targeted therapies for cancer, as it acts by inhibiting the galactosylation process essential for tumor growth and metastasis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 92748-40-8 |
| Pricing | Inquire |
| Cas | 92748-40-8 |
| Molecular Weight | 584.29 |
| Molecular Formula | C15H23FN2O17P2 |
| Canonical SMILES | C1=C(C(=O)NC(=O)N1C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OC3C(C(C(C(O3)CO)O)O)O)O)O)F |