9-(2',3',5'-Tri-O-benzoyl-2'-C-methyl-b-D-ribofuranosyl)6-methylpurine
9-(2',3',5'-Tri-O-benzoyl-2'-C-methyl-b-D-ribofuranosyl)6-methylpurine is a vital compound exhibiting promising anti-viral properties and employed in the research of various viral diseases. With its unique chemical structure, It acts effectively against specific DNA and RNA viruses.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2095417-61-9 |
| Pricing | Inquire |
| Cas | 2095417-61-9 |
| Molecular Weight | 592.60 |
| Molecular Formula | C33H28N4O7 |
| Canonical SMILES | CC1=C2C(=NC=N1)N(C=N2)C3C(C(C(O3)COC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5)(C)OC(=O)C6=CC=CC=C6 |