Caspase-1/ICE Inhibitor Z-WEHD-FMK
Supplier | Creative Peptides |
---|---|
Product # | R0900 |
CAS # | 210345-00-9 |
Pricing | Inquire |
LabelingTarget | Caspase-1/ Caspase-5 |
Synonyms | Caspase-1 inhibitor (fluoromethylketone), Caspase-5 inhibitor (fluoromethylketone) |
MolecularFormula | C37H42FN7O11 |
MolecularWeight | 763.78 |
Source | Synthetic |
Sequence | Z-Trp-Glu(OMe)-His-Asp(OMe)-fluoromethylketone |
Storage | -20°C |
Explanation | Z-WEHD-FMK is an effective, cell-permeable and irreversible inhibitor of caspase-1, caspase-5 and cathepsin B (IC50 = 6 µM). It can inhibit apoptosis in multiple biological systems. |
Activity | Inhibitor |
InChI | InChI=1S/C37H42FN7O10/c1-53-32(47)13-12-27(34(49)44-30(15-24-19-39-21-41-24)36(51)43-28(31(46)17-38)16-33(48)54-2)42-35(50)29(14-23-18-40-26-11-7-6-10-25(23)26)45-37(52)55-20-22-8-4-3-5-9-22/h3-11,18-19,21,27-30,40H,12-17,20H2,1-2H3,(H,39,41)(H,42,50)(H,43,51)(H,44,49)(H,45,52)/t27-,28-,29-,30-/m0/s1 |
InChIKey | NLZNSSWGRVBWIX-KRCBVYEFSA-N |
Purity | >99% |
LongTermStorageConditions | -20 °C |