Xanthosine-5'-Triphosphate
Xanthosine-5'-Triphosphate, known as XTP, holds immense significance within the biomedical sector. It serves as an essential building block for RNA and DNA synthesis, thereby playing a pivotal role in genetic material generation. Its versatility extends to governing crucial cellular operations like protein synthesis, signaling pathways, and enzymatic reactions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 6253-56-1 |
| Pricing | Inquire |
| Cas | 6253-56-1 |
| Molecular Weight | 524.16 (free acid) |
| Molecular Formula | C10H15N4O15P3(free acid) |
| Canonical SMILES | C1=NC2=C(N1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)NC(=O)NC2=O |