Chloroquine-[d5] Diphosphate
Chloroquine-[d5] Diphosphate, is the labelled analogue of Chloroquine Diphosphate. Chloroquine phosphate is an antimalarial drug and weak intercalating agent. It inhibits TLR signalling in plasmacytoid dendritic cells (pDCs). It has been used in emergency of COVID-19.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002228 |
| Pricing | Inquire |
| Cas | 1854126-42-3 |
| Molecular Weight | 520.9 |
| Molecular Formula | C18H21D5ClN3D5.2H3O4P |
| Canonical SMILES | CCN(CC)CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl.OP(=O)(O)O.OP(=O)(O)O |