Lobophorin B
Lobophorin B is a natural product that has been found in Streptomyces. Lobophorin compounds exhibit diverse biological activities including antimicrobial and anticancer. Lobophorin B is also an antibiotic with anti-inflammatory properties.
| Supplier | BOC Sciences |
|---|---|
| Product # | 78798-30-8 |
| Pricing | Inquire |
| Cas | 78798-30-8 |
| Molecular Weight | 1187.36 |
| Molecular Formula | C61H90N2O21 |
| Canonical SMILES | CC1CC(C(C2C1C3(C(C=C2)C(=CCC(C(=CC4C=C(C(CC45C(=O)C(=C3O)C(=O)O5)C)CO)C)OC6CC(C(C(O6)C)NC(=O)OC)(C)[N+](=O)[O-])C)C)OC7CC(C(C(O7)C)O)OC8CC(C(C(O8)C)OC9CC(C(C(O9)C)OC)O)O)C |