3-Bromo-4-(4-isopropoxyphenyl)-1-(triisopropylsilyl)-1H-pyrrole
3-Bromo-4-(4-isopropoxyphenyl)-1-(triisopropylsilyl)-1H-pyrrole is an intermediate for the synthesis of MS094 (M755450), which is a derivative of MS023 (M755443). MS023 is a potent inihbitor of PRMTs 1,3,4,6,and 8 (IC50 = 30, 119, 83, 8, and 8 nM, respectively), which are responsible for asymmetric dimethylation of arginine residues.
Supplier | BOC Sciences |
---|---|
Product # | BB070802 |
Pricing | Inquire |
Cas | 1831110-70-3 |
Molecular Weight | 436.5 |
Molecular Formula | C22H34BrNOSi |
Canonical SMILES | CC(C)OC1=CC=C(C=C1)C2=CN(C=C2Br)[Si](C(C)C)(C(C)C)C(C)C |