Methyl 2-(Chloromethyl)-3-nitrobenzoate
Methyl 2-(Chloromethyl)-3-nitrobenzoate is derived from Methyl 2-Methyl-3-nitrobenzoate (M320165), which is used as a reagent to synthesize Lenalidomide (L328000). Lenalidomide is a compound that exhibits antimyeloma, anticancer and immunomodulatory activity and is used to treat patients with B-cell malignancies.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB075950 |
| Pricing | Inquire |
| Cas | 1218910-61-2 |
| Molecular Weight | 229.62 |
| Molecular Formula | C9H8ClNO4 |
| Canonical SMILES | COC(=O)C1=C(C(=CC=C1)[N+](=O)[O-])CCl |