N4-Benzoyl-2'-O-methylcytidine
N4-Benzoyl-2'-O-methylcytidine, a highly effective biomedicine, emerges as a paramount intervention for combating RNA viruses that induce viral infections. Renowned for its antiviral attributes, this groundbreaking product has garnered substantial scientific attention. Notably, its exceptional efficacy in addressing afflictions such as influenza and hepatitis has been extensively documented.
Supplier | BOC Sciences |
---|---|
Product # | 52571-45-6 |
Pricing | Inquire |
Cas | 52571-45-6 |
Molecular Weight | 361.35 |
Molecular Formula | C17H19N3O6 |
Canonical SMILES | COC1C(C(OC1N2C=CC(=NC2=O)NC(=O)C3=CC=CC=C3)CO)O |