Iduronic acid
L-Iduronic acid is a crucial component in the biomedical industry used for various purposes. It is commonly employed in the synthesis of dermatan sulfate, a polysaccharide found in connective tissues. Additionally, L-Iduronic acid is utilized in the production of heparan sulfate, a glycosaminoglycan involved in different biological processes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 3402-98-0 |
| Pricing | Inquire |
| Cas | 3402-98-0 |
| Molecular Weight | 194.14 |
| Molecular Formula | C6H10O7 |
| Canonical SMILES | O=CC(O)C(O)C(O)C(O)C(=O)O |