Stresgenin B
Stresgenin B is a heat-induced heat shock protein (HSP) gene expression inhibitor produced by Streptomyces sp. AS-9. It can inhibit the expression of heat-induced luciferase reporter gene, and also inhibit the synthesis of heat-induced hsp72/73, hsp90 and hsp110. It has moderate cytotoxicity to tumor cell lines such as K562, PC6, HT29, and has antimicrobial activity against Micrococcus luteus, Staphylococcus aureus and Bacillus subtilis.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-03078 |
| Pricing | Inquire |
| Molecular Weight | 239.22 |
| Molecular Formula | C11H13NO5 |
| Canonical SMILES | CC1(OC2C=CC(=CC(=O)OC)C2O1)C(=O)N |