Adenylyl-(3'-5')-guanosine monoammonium salt
Adenylyl-(3'-5')-guanosine monoammonium salt is an indispensable biomedical instrument used in scientific investigations, playing an imperative role in unraveling intricate cellular signaling pathways and elucidating the enigmatic realm of nucleotide metabolism. This remarkable compound acting as a precursor for the formation of cyclic adenosine monophosphate (cAMP), a critical molecule that orchestrates multifarious biological processes, encompassing compound responses, enzyme activation and hormonal regulation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 102029-53-8 |
| Pricing | Inquire |
| Cas | 102029-53-8 |
| Molecular Weight | 629.48 |
| Molecular Formula | C20H25N10O11P.H3N |
| Canonical SMILES | O=C1N=C(N)NC2=C1N=CN2C3OC(COP(=O)(O)OC4C(O)C(OC4CO)N5C=NC=6C(=NC=NC65)N)C(O)C3O.N |