b-Aescin
b-Aescin, a natural compound extracted from the seeds of the horse chestnut tree, serves as a prominent treatment option in the biomedical industry for chronic venous insufficiency, presenting benefits such as symptom alleviation of edema and pain. This versatile compound also exhibits anti-inflammatory properties and promising indications of inhibiting tumor growth in specified cancer cell lines, making it an invaluable asset in the medical community.
| Supplier | BOC Sciences |
|---|---|
| Product # | 11072-93-8 |
| Pricing | Inquire |
| Cas | 11072-93-8 |
| Molecular Weight | 1131.26 |
| Molecular Formula | C55H86O24 |
| Canonical SMILES | CC=C(C)C(=O)OC1C(C2(C(CC1(C)C)C3=CCC4C5(CCC(C(C5CCC4(C3(CC2O)C)C)(C)CO)OC6C(C(C(C(O6)C(=O)O)OC7C(C(C(C(O7)CO)O)O)O)O)OC8C(C(C(C(O8)CO)O)O)O)C)CO)OC(=O)C |