RO-3
RO-3 is a selective homomeric P2X3 and heteromeric P2X2/3 receptor antagonist (pIC50 values are 7.0 and 5.9 respectively). RO-3 is used in a combination of compounds to develop a substance used for alleviating pain and skin disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1026582-88-6 |
| Pricing | Inquire |
| Cas | 1026582-88-6 |
| Molecular Weight | 302.37 |
| Molecular Formula | C16H22N4O2 |
| Canonical SMILES | CC(C)C1=CC(=C(C=C1CC2=CN=C(N=C2N)N)OC)OC |