2-Azidoethyl b-D-fructopyranoside
2-Azidoethyl b-D-fructopyranoside is a compound of immense significance in the biomedical field, serving as a pivotal substrate, facilitating exhaustive exploration into intricate enzymatic reactions that shed light on the enigmatic realm of carbohydrate metabolism.
| Supplier | BOC Sciences |
|---|---|
| Product # | 99042-58-7 |
| Pricing | Inquire |
| Cas | 99042-58-7 |
| Molecular Weight | 249.22 |
| Molecular Formula | C8H15N3O6 |
| Canonical SMILES | C(COC1(C(C(C(O1)CO)O)O)CO)N=[N+]=[N-] |