N6-Benzoyl-7-deaza-2'-deoxy-7-iodoadenosine
N6-Benzoyl-7-deaza-2'-deoxy-7-iodoadenosine is a potent and selective inhibitor used in the biomedical industry to target adenosine receptors. With its unique chemical structure and properties, it shows potential in treating various neurodegenerative disorders and autoimmune diseases. Extensive research reveals its ability to modulate immune responses and alleviate symptoms associated with inflammation, such as rheumatoid arthritis and multiple sclerosis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 214833-21-3 |
| Pricing | Inquire |
| Cas | 214833-21-3 |
| Molecular Weight | 480.3 |
| Molecular Formula | C18H17IN4O4 |
| Canonical SMILES | C1C(C(OC1N2C=C(C3=C(N=CN=C32)NC(=O)C4=CC=CC=C4)I)CO)O |