HA-1077 dihydrochloride
HA-1077 is a potent and selective inhibitor of Rho kinase (ROCK). HA-1077 exhibited neuroprotective effects and enhanced cognition in mouse models of amyotrophic lateral sclerosis (ALS), suggesting its potential use for cognitive disorders such as ALS, Alzheimer's disease and spinal muscular atrophy. It also suppresses tumor cell motility and metastasis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 203911-27-7 |
| Pricing | Inquire |
| Cas | 203911-27-7 |
| Molecular Weight | 364.3 |
| Molecular Formula | C14H17N3O2S·2HCl |
| Canonical SMILES | C1CNCCN(C1)S(=O)(=O)C2=CC=CC3=C2C=CN=C3.Cl.Cl |