Oxytetracycline EP Impurity A
Oxytetracycline EP Impurity A is an impurity of Oxytetracycline, which is a broad-spectrum tetracycline antibiotic used for the treatment of various infectious diseases, like anthrax, Chlamydia, cholera, typhus, relapsing fever, malaria, plaque, syphilis, respiratory infection, streptococcal infection, and acne.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-04440 |
| Pricing | Inquire |
| Cas | 14206-58-7 |
| Molecular Weight | 460.43 |
| Molecular Formula | C22H24N2O9 |
| Canonical SMILES | O=C(N)C=1C(=O)C2(O)C(O)=C3C(=O)C=4C(O)=CC=CC4C(O)(C)C3C(O)C2C(C1O)N(C)C |