Glucagon receptor antagonists 1
Glucagon receptor antagonists-1 is a highly potent glucagon receptor antagonist, which is activated by glucagon and is a member of the class B G-protein coupled family of receptors.
| Supplier | BOC Sciences |
|---|---|
| Product # | 503559-84-0 |
| Pricing | Inquire |
| Cas | 503559-84-0 |
| Molecular Weight | 447.59 |
| Molecular Formula | C29H34FNO2 |
| Canonical SMILES | CC=CC1=C(C(=C(N=C1C(C)C)C(C)C)C(C)O)C2=C(C=C(C=C2)F)OCC3=CC=CC=C3 |