5,6-O-Isopropylidene-3-C-methyl-D-manno-1,4-lactone
5,6-O-Isopropylidene-3-C-methyl-D-manno-1,4-lactone, hailed as a multifaceted entity, holds a prominent position within the expansive realm of the biomedical domain. With a chemical architecture that distinguishes it from the rest, this compound finds wide-ranging utility in the triumphant synthesis of pharmaceutical wonders. It has triumphantly showcased its prowess in tackling an array of afflictions, spanning from the tenacious grasp of cancer to the intricate complexities of cardiovascular disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1025774-02-0 |
| Pricing | Inquire |
| Cas | 1025774-02-0 |
| Molecular Weight | 232.23 |
| Molecular Formula | C10H16O6 |
| Canonical SMILES | CC1(OCC(O1)C2C(C(C(=O)O2)O)(C)O)C |