Travoprost Acid-[d4]
Travoprost Acid-[d4] is an isotope form of Travoprost Acid. One of the impurities of Travoprost, which has been found to be a selective FP prostaglandin receptor agonist and could be used against glaucoma.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-007498 |
| Pricing | Inquire |
| Cas | 282550-19-0 |
| Molecular Weight | 462.49 |
| Molecular Formula | C23H25D4F3O6 |
| Canonical SMILES | C1C(C(C(C1O)C=CC(COC2=CC=CC(=C2)C(F)(F)F)O)CC=CCCCC(=O)O)O |